C10H12Cl2O3 — CID 60884982
1-[2,4-dichloro-6-(hydroxymethyl)phenoxy]propan-2-ol (PubChem CID 60884982) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1-[2,4-dichloro-6-(hydroxymethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[2,4-dichloro-6-(hydroxymethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 60884982 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-[2,4-dichloro-6-(hydroxymethyl)phenoxy]propan-2-ol |
| SMILES | CC(O)COc1c(Cl)cc(Cl)cc1CO |
| InChI | InChI=1S/C10H12Cl2O3/c1-6(14)5-15-10-7(4-13)2-8(11)3-9(10)12/h2-3,6,13-14H,4-5H2,1H3 |
| InChIKey | YROYVJGXWSAWPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |