C10H12Cl2O2 — CID 90679727
1-(2,6-dichloro-4-methylphenoxy)propan-2-ol (PubChem CID 90679727) has the molecular formula C10H12Cl2O2 and a molecular weight of 235.11 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-methylphenoxy)propan-2-ol.
| Compound Name | 1-(2,6-dichloro-4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 90679727 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1-(2,6-dichloro-4-methylphenoxy)propan-2-ol |
| SMILES | Cc1cc(Cl)c(OCC(C)O)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O2/c1-6-3-8(11)10(9(12)4-6)14-5-7(2)13/h3-4,7,13H,5H2,1-2H3 |
| InChIKey | ARGLHPOHOYRVME-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |