C11H16ClNO2 — CID 83893998
2-amino-1-(3-chloro-2-ethoxy-5-methylphenyl)ethanol (PubChem CID 83893998) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-2-ethoxy-5-methylphenyl)ethanol.
| Compound Name | 2-amino-1-(3-chloro-2-ethoxy-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 83893998 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-1-(3-chloro-2-ethoxy-5-methylphenyl)ethanol |
| SMILES | CCOc1c(Cl)cc(C)cc1C(O)CN |
| InChI | InChI=1S/C11H16ClNO2/c1-3-15-11-8(10(14)6-13)4-7(2)5-9(11)12/h4-5,10,14H,3,6,13H2,1-2H3 |
| InChIKey | SOVWHTKHFHPWBM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |