C16H21ClO4 — CID 117497861
ethyl 2-[3-chloro-2-(cyclobutylmethoxy)-5-methylphenyl]-2-hydroxyacetate (PubChem CID 117497861) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is ethyl 2-[3-chloro-2-(cyclobutylmethoxy)-5-methylphenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[3-chloro-2-(cyclobutylmethoxy)-5-methylphenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117497861 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 2-[3-chloro-2-(cyclobutylmethoxy)-5-methylphenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(C)cc(Cl)c1OCC1CCC1 |
| InChI | InChI=1S/C16H21ClO4/c1-3-20-16(19)14(18)12-7-10(2)8-13(17)15(12)21-9-11-5-4-6-11/h7-8,11,14,18H,3-6,9H2,1-2H3 |
| InChIKey | XZCXRNYRVBKEHF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |