C15H21ClO4 — CID 117484496
ethyl 2-(5-tert-butyl-3-chloro-2-methoxyphenyl)-2-hydroxyacetate (PubChem CID 117484496) has the molecular formula C15H21ClO4 and a molecular weight of 300.78 g/mol. Its IUPAC name is ethyl 2-(5-tert-butyl-3-chloro-2-methoxyphenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(5-tert-butyl-3-chloro-2-methoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117484496 |
| Molecular Formula | C15H21ClO4 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 2-(5-tert-butyl-3-chloro-2-methoxyphenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(C(C)(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C15H21ClO4/c1-6-20-14(18)12(17)10-7-9(15(2,3)4)8-11(16)13(10)19-5/h7-8,12,17H,6H2,1-5H3 |
| InChIKey | OAVVNSSPVOELNZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |