C13H16ClFO3 — CID 117439261
ethyl 2-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-2-hydroxyacetate (PubChem CID 117439261) has the molecular formula C13H16ClFO3 and a molecular weight of 274.72 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117439261 |
| Molecular Formula | C13H16ClFO3 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 2-[2-chloro-4-(2-fluoropropan-2-yl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc(C(C)(C)F)cc1Cl |
| InChI | InChI=1S/C13H16ClFO3/c1-4-18-12(17)11(16)9-6-5-8(7-10(9)14)13(2,3)15/h5-7,11,16H,4H2,1-3H3 |
| InChIKey | FWKTUKVXHUJNQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |