C11H10BrF3O3 — CID 117108846
ethyl 2-[4-bromo-2-(trifluoromethyl)phenyl]-2-hydroxyacetate (PubChem CID 117108846) has the molecular formula C11H10BrF3O3 and a molecular weight of 327.10 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-(trifluoromethyl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[4-bromo-2-(trifluoromethyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117108846 |
| Molecular Formula | C11H10BrF3O3 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | ethyl 2-[4-bromo-2-(trifluoromethyl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O3/c1-2-18-10(17)9(16)7-4-3-6(12)5-8(7)11(13,14)15/h3-5,9,16H,2H2,1H3 |
| InChIKey | WGQALIXWKKPCIY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |