C11H10ClF3O4 — CID 117481023
ethyl 2-[5-chloro-2-hydroxy-3-(trifluoromethyl)phenyl]-2-hydroxyacetate (PubChem CID 117481023) has the molecular formula C11H10ClF3O4 and a molecular weight of 298.64 g/mol. Its IUPAC name is ethyl 2-[5-chloro-2-hydroxy-3-(trifluoromethyl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[5-chloro-2-hydroxy-3-(trifluoromethyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117481023 |
| Molecular Formula | C11H10ClF3O4 |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | ethyl 2-[5-chloro-2-hydroxy-3-(trifluoromethyl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(Cl)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C11H10ClF3O4/c1-2-19-10(18)9(17)6-3-5(12)4-7(8(6)16)11(13,14)15/h3-4,9,16-17H,2H2,1H3 |
| InChIKey | AEVRPVUDHZFOOY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |