C11H11F3O4 — CID 117414481
ethyl 2-hydroxy-2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetate (PubChem CID 117414481) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 117414481 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | ethyl 2-hydroxy-2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(O)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C11H11F3O4/c1-2-18-10(17)9(16)7-4-3-6(5-8(7)15)11(12,13)14/h3-5,9,15-16H,2H2,1H3 |
| InChIKey | XCAJRKCVZLYNQY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |