C12H15ClO3 — CID 117358770
ethyl 2-(5-chloro-2,3-dimethylphenyl)-2-hydroxyacetate (PubChem CID 117358770) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is ethyl 2-(5-chloro-2,3-dimethylphenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(5-chloro-2,3-dimethylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117358770 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 2-(5-chloro-2,3-dimethylphenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(Cl)cc(C)c1C |
| InChI | InChI=1S/C12H15ClO3/c1-4-16-12(15)11(14)10-6-9(13)5-7(2)8(10)3/h5-6,11,14H,4H2,1-3H3 |
| InChIKey | JFNDFJYQWQNYMY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |