C11H11ClO5 — CID 117400231
ethyl 2-(6-chloro-1,3-benzodioxol-4-yl)-2-hydroxyacetate (PubChem CID 117400231) has the molecular formula C11H11ClO5 and a molecular weight of 258.66 g/mol. Its IUPAC name is ethyl 2-(6-chloro-1,3-benzodioxol-4-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(6-chloro-1,3-benzodioxol-4-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117400231 |
| Molecular Formula | C11H11ClO5 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | ethyl 2-(6-chloro-1,3-benzodioxol-4-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C11H11ClO5/c1-2-15-11(14)9(13)7-3-6(12)4-8-10(7)17-5-16-8/h3-4,9,13H,2,5H2,1H3 |
| InChIKey | LXSBUSUBTYFTIM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |