C11H11FO5 — CID 117356992
ethyl 2-(4-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetate (PubChem CID 117356992) has the molecular formula C11H11FO5 and a molecular weight of 242.20 g/mol. Its IUPAC name is ethyl 2-(4-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(4-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117356992 |
| Molecular Formula | C11H11FO5 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | ethyl 2-(4-fluoro-1,3-benzodioxol-5-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc2c(c1F)OCO2 |
| InChI | InChI=1S/C11H11FO5/c1-2-15-11(14)9(13)6-3-4-7-10(8(6)12)17-5-16-7/h3-4,9,13H,2,5H2,1H3 |
| InChIKey | FCSJAJADMWTJFG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |