C10H11BO7 — CID 117388047
[5-(1-hydroxy-2-methoxy-2-oxoethyl)-1,3-benzodioxol-4-yl]boronic acid (PubChem CID 117388047) has the molecular formula C10H11BO7 and a molecular weight of 254.00 g/mol. Its IUPAC name is [5-(1-hydroxy-2-methoxy-2-oxoethyl)-1,3-benzodioxol-4-yl]boronic acid.
| Compound Name | [5-(1-hydroxy-2-methoxy-2-oxoethyl)-1,3-benzodioxol-4-yl]boronic acid |
|---|---|
| PubChem CID | 117388047 |
| Molecular Formula | C10H11BO7 |
| Molecular Weight | 254.00 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [5-(1-hydroxy-2-methoxy-2-oxoethyl)-1,3-benzodioxol-4-yl]boronic acid |
| SMILES | COC(=O)C(O)c1ccc2c(c1B(O)O)OCO2 |
| InChI | InChI=1S/C10H11BO7/c1-16-10(13)8(12)5-2-3-6-9(18-4-17-6)7(5)11(14)15/h2-3,8,12,14-15H,4H2,1H3 |
| InChIKey | RTLAMOHTUYAAGT-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.00 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|