C10H12BNO5 — CID 117345900
[5-(3-aminopropanoyl)-1,3-benzodioxol-4-yl]boronic acid (PubChem CID 117345900) has the molecular formula C10H12BNO5 and a molecular weight of 237.02 g/mol. Its IUPAC name is [5-(3-aminopropanoyl)-1,3-benzodioxol-4-yl]boronic acid.
| Compound Name | [5-(3-aminopropanoyl)-1,3-benzodioxol-4-yl]boronic acid |
|---|---|
| PubChem CID | 117345900 |
| Molecular Formula | C10H12BNO5 |
| Molecular Weight | 237.02 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [5-(3-aminopropanoyl)-1,3-benzodioxol-4-yl]boronic acid |
| SMILES | NCCC(=O)c1ccc2c(c1B(O)O)OCO2 |
| InChI | InChI=1S/C10H12BNO5/c12-4-3-7(13)6-1-2-8-10(17-5-16-8)9(6)11(14)15/h1-2,14-15H,3-5,12H2 |
| InChIKey | DWIXYGWBYAKYCB-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.02 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|