C11H14BNO6 — CID 117420925
4-amino-4-(4-borono-1,3-benzodioxol-5-yl)butanoic acid (PubChem CID 117420925) has the molecular formula C11H14BNO6 and a molecular weight of 267.05 g/mol. Its IUPAC name is 4-amino-4-(4-borono-1,3-benzodioxol-5-yl)butanoic acid.
| Compound Name | 4-amino-4-(4-borono-1,3-benzodioxol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117420925 |
| Molecular Formula | C11H14BNO6 |
| Molecular Weight | 267.05 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-amino-4-(4-borono-1,3-benzodioxol-5-yl)butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccc2c(c1B(O)O)OCO2 |
| InChI | InChI=1S/C11H14BNO6/c13-7(2-4-9(14)15)6-1-3-8-11(19-5-18-8)10(6)12(16)17/h1,3,7,16-17H,2,4-5,13H2,(H,14,15) |
| InChIKey | ISYAKGRTNGUVAW-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.05 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|