C7H7BO5 — CID 130034822
(5-hydroxy-1,3-benzodioxol-4-yl)boronic acid (PubChem CID 130034822) has the molecular formula C7H7BO5 and a molecular weight of 181.94 g/mol. Its IUPAC name is (5-hydroxy-1,3-benzodioxol-4-yl)boronic acid.
| Compound Name | (5-hydroxy-1,3-benzodioxol-4-yl)boronic acid |
|---|---|
| PubChem CID | 130034822 |
| Molecular Formula | C7H7BO5 |
| Molecular Weight | 181.94 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (5-hydroxy-1,3-benzodioxol-4-yl)boronic acid |
| SMILES | OB(O)c1c(O)ccc2c1OCO2 |
| InChI | InChI=1S/C7H7BO5/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2,9-11H,3H2 |
| InChIKey | CUJPGJPUAGUELW-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.94 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|