C13H17NO3 — CID 117342196
4-[1-(aminomethyl)cyclopentyl]-1,3-benzodioxol-5-ol (PubChem CID 117342196) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-[1-(aminomethyl)cyclopentyl]-1,3-benzodioxol-5-ol.
| Compound Name | 4-[1-(aminomethyl)cyclopentyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117342196 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-[1-(aminomethyl)cyclopentyl]-1,3-benzodioxol-5-ol |
| SMILES | NCC1(c2c(O)ccc3c2OCO3)CCCC1 |
| InChI | InChI=1S/C13H17NO3/c14-7-13(5-1-2-6-13)11-9(15)3-4-10-12(11)17-8-16-10/h3-4,15H,1-2,5-8,14H2 |
| InChIKey | OVGQXJAHXAVRKE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |