C13H16ClNO2 — CID 117387219
[1-(5-chloro-1,3-benzodioxol-4-yl)cyclopentyl]methanamine (PubChem CID 117387219) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is [1-(5-chloro-1,3-benzodioxol-4-yl)cyclopentyl]methanamine.
| Compound Name | [1-(5-chloro-1,3-benzodioxol-4-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117387219 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | [1-(5-chloro-1,3-benzodioxol-4-yl)cyclopentyl]methanamine |
| SMILES | NCC1(c2c(Cl)ccc3c2OCO3)CCCC1 |
| InChI | InChI=1S/C13H16ClNO2/c14-9-3-4-10-12(17-8-16-10)11(9)13(7-15)5-1-2-6-13/h3-4H,1-2,5-8,15H2 |
| InChIKey | CJIZEAWRQZSZEJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |