C9H10O4 — CID 117279028
5-(2-hydroxyethyl)-1,3-benzodioxol-4-ol (PubChem CID 117279028) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1,3-benzodioxol-4-ol.
| Compound Name | 5-(2-hydroxyethyl)-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117279028 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 5-(2-hydroxyethyl)-1,3-benzodioxol-4-ol |
| SMILES | OCCc1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C9H10O4/c10-4-3-6-1-2-7-9(8(6)11)13-5-12-7/h1-2,10-11H,3-5H2 |
| InChIKey | UQXXCMUBYPOSDV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |