C8H9NO4 — CID 117279345
5-(aminooxymethyl)-1,3-benzodioxol-4-ol (PubChem CID 117279345) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 5-(aminooxymethyl)-1,3-benzodioxol-4-ol.
| Compound Name | 5-(aminooxymethyl)-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117279345 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-(aminooxymethyl)-1,3-benzodioxol-4-ol |
| SMILES | NOCc1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C8H9NO4/c9-13-3-5-1-2-6-8(7(5)10)12-4-11-6/h1-2,10H,3-4,9H2 |
| InChIKey | FCCTYYZGWBDENI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|