C8H8BrNO4 — CID 117409291
4-(aminooxymethyl)-6-bromo-1,3-benzodioxol-5-ol (PubChem CID 117409291) has the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. Its IUPAC name is 4-(aminooxymethyl)-6-bromo-1,3-benzodioxol-5-ol.
| Compound Name | 4-(aminooxymethyl)-6-bromo-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117409291 |
| Molecular Formula | C8H8BrNO4 |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 4-(aminooxymethyl)-6-bromo-1,3-benzodioxol-5-ol |
| SMILES | NOCc1c(O)c(Br)cc2c1OCO2 |
| InChI | InChI=1S/C8H8BrNO4/c9-5-1-6-8(13-3-12-6)4(2-14-10)7(5)11/h1,11H,2-3,10H2 |
| InChIKey | VLZINIINVVHBCE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|