C11H11BrO4 — CID 117462715
3-(7-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)propanal (PubChem CID 117462715) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 3-(7-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)propanal.
| Compound Name | 3-(7-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)propanal |
|---|---|
| PubChem CID | 117462715 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 3-(7-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-5-yl)propanal |
| SMILES | O=CCCc1c(O)c(Br)cc2c1OCCO2 |
| InChI | InChI=1S/C11H11BrO4/c12-8-6-9-11(16-5-4-15-9)7(10(8)14)2-1-3-13/h3,6,14H,1-2,4-5H2 |
| InChIKey | GUOSKGKOIJELQO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|