C12H11F3O3 — CID 117404235
3-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal (PubChem CID 117404235) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 3-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal.
| Compound Name | 3-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal |
|---|---|
| PubChem CID | 117404235 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-[6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal |
| SMILES | O=CCCc1c(C(F)(F)F)ccc2c1OCCO2 |
| InChI | InChI=1S/C12H11F3O3/c13-12(14,15)9-3-4-10-11(18-7-6-17-10)8(9)2-1-5-16/h3-5H,1-2,6-7H2 |
| InChIKey | PQMAOILGOKZLCX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|