C14H17FO3 — CID 117383689
3-[7-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal (PubChem CID 117383689) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-[7-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal.
| Compound Name | 3-[7-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal |
|---|---|
| PubChem CID | 117383689 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-[7-(2-fluoropropan-2-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanal |
| SMILES | CC(C)(F)c1cc(CCC=O)c2c(c1)OCCO2 |
| InChI | InChI=1S/C14H17FO3/c1-14(2,15)11-8-10(4-3-5-16)13-12(9-11)17-6-7-18-13/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | ONNKJMDOIRKXES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|