C11H10BrNO4 — CID 117482887
8-bromo-6-(isocyanatomethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol (PubChem CID 117482887) has the molecular formula C11H10BrNO4 and a molecular weight of 300.11 g/mol. Its IUPAC name is 8-bromo-6-(isocyanatomethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol.
| Compound Name | 8-bromo-6-(isocyanatomethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol |
|---|---|
| PubChem CID | 117482887 |
| Molecular Formula | C11H10BrNO4 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 8-bromo-6-(isocyanatomethyl)-3,4-dihydro-2H-1,5-benzodioxepin-7-ol |
| SMILES | O=C=NCc1c(O)c(Br)cc2c1OCCCO2 |
| InChI | InChI=1S/C11H10BrNO4/c12-8-4-9-11(17-3-1-2-16-9)7(10(8)15)5-13-6-14/h4,15H,1-3,5H2 |
| InChIKey | RYDJGHNFHNKSGS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|