C10H8ClNO4 — CID 117355985
6-chloro-5-(isocyanatomethyl)-2,3-dihydro-1,4-benzodioxin-7-ol (PubChem CID 117355985) has the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. Its IUPAC name is 6-chloro-5-(isocyanatomethyl)-2,3-dihydro-1,4-benzodioxin-7-ol.
| Compound Name | 6-chloro-5-(isocyanatomethyl)-2,3-dihydro-1,4-benzodioxin-7-ol |
|---|---|
| PubChem CID | 117355985 |
| Molecular Formula | C10H8ClNO4 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 6-chloro-5-(isocyanatomethyl)-2,3-dihydro-1,4-benzodioxin-7-ol |
| SMILES | O=C=NCc1c(Cl)c(O)cc2c1OCCO2 |
| InChI | InChI=1S/C10H8ClNO4/c11-9-6(4-12-5-13)10-8(3-7(9)14)15-1-2-16-10/h3,14H,1-2,4H2 |
| InChIKey | JXZJLYVUMGCKHC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|