C10H12O4 — CID 90370994
6-ethyl-2,3-dihydro-1,4-benzodioxine-5,7-diol (PubChem CID 90370994) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 6-ethyl-2,3-dihydro-1,4-benzodioxine-5,7-diol.
| Compound Name | 6-ethyl-2,3-dihydro-1,4-benzodioxine-5,7-diol |
|---|---|
| PubChem CID | 90370994 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 6-ethyl-2,3-dihydro-1,4-benzodioxine-5,7-diol |
| SMILES | CCc1c(O)cc2c(c1O)OCCO2 |
| InChI | InChI=1S/C10H12O4/c1-2-6-7(11)5-8-10(9(6)12)14-4-3-13-8/h5,11-12H,2-4H2,1H3 |
| InChIKey | GQWFKIDMKPNPFM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |