C10H10BrClO2 — CID 84714678
7-bromo-5-chloro-6-ethyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 84714678) has the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. Its IUPAC name is 7-bromo-5-chloro-6-ethyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-bromo-5-chloro-6-ethyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 84714678 |
| Molecular Formula | C10H10BrClO2 |
| Molecular Weight | 277.54 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 7-bromo-5-chloro-6-ethyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1c(Br)cc2c(c1Cl)OCCO2 |
| InChI | InChI=1S/C10H10BrClO2/c1-2-6-7(11)5-8-10(9(6)12)14-4-3-13-8/h5H,2-4H2,1H3 |
| InChIKey | NWEXSTOXWYJBPP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |