C12H16ClNO3 — CID 117397732
5-(4-aminobutyl)-6-chloro-2,3-dihydro-1,4-benzodioxin-7-ol (PubChem CID 117397732) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-(4-aminobutyl)-6-chloro-2,3-dihydro-1,4-benzodioxin-7-ol.
| Compound Name | 5-(4-aminobutyl)-6-chloro-2,3-dihydro-1,4-benzodioxin-7-ol |
|---|---|
| PubChem CID | 117397732 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-(4-aminobutyl)-6-chloro-2,3-dihydro-1,4-benzodioxin-7-ol |
| SMILES | NCCCCc1c(Cl)c(O)cc2c1OCCO2 |
| InChI | InChI=1S/C12H16ClNO3/c13-11-8(3-1-2-4-14)12-10(7-9(11)15)16-5-6-17-12/h7,15H,1-6,14H2 |
| InChIKey | MARWWENLHVAVAV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|