C9H10ClNO3 — CID 84681333
7-(aminomethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 84681333) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is 7-(aminomethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-(aminomethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 84681333 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 7-(aminomethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | NCc1cc2c(c(Cl)c1O)OCCO2 |
| InChI | InChI=1S/C9H10ClNO3/c10-7-8(12)5(4-11)3-6-9(7)14-2-1-13-6/h3,12H,1-2,4,11H2 |
| InChIKey | BZYAHTXSPSZWPP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|