C8H10ClNO2 — CID 84770587
4-(aminomethyl)-2-chloro-6-methylbenzene-1,3-diol (PubChem CID 84770587) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is 4-(aminomethyl)-2-chloro-6-methylbenzene-1,3-diol.
| Compound Name | 4-(aminomethyl)-2-chloro-6-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 84770587 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 4-(aminomethyl)-2-chloro-6-methylbenzene-1,3-diol |
| SMILES | Cc1cc(CN)c(O)c(Cl)c1O |
| InChI | InChI=1S/C8H10ClNO2/c1-4-2-5(3-10)8(12)6(9)7(4)11/h2,11-12H,3,10H2,1H3 |
| InChIKey | YPFVZELWZSVIJJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|