C9H12ClN — CID 22980871
(4-chloro-2,5-dimethylphenyl)methanamine (PubChem CID 22980871) has the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. Its IUPAC name is (4-chloro-2,5-dimethylphenyl)methanamine.
| Compound Name | (4-chloro-2,5-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 22980871 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (4-chloro-2,5-dimethylphenyl)methanamine |
| SMILES | Cc1cc(CN)c(C)cc1Cl |
| InChI | InChI=1S/C9H12ClN/c1-6-4-9(10)7(2)3-8(6)5-11/h3-4H,5,11H2,1-2H3 |
| InChIKey | QTQXSCWLJPRCQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |