C9H11ClO2 — CID 84770210
2-chloro-5-(hydroxymethyl)-3,6-dimethylphenol (PubChem CID 84770210) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is 2-chloro-5-(hydroxymethyl)-3,6-dimethylphenol.
| Compound Name | 2-chloro-5-(hydroxymethyl)-3,6-dimethylphenol |
|---|---|
| PubChem CID | 84770210 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-chloro-5-(hydroxymethyl)-3,6-dimethylphenol |
| SMILES | Cc1cc(CO)c(C)c(O)c1Cl |
| InChI | InChI=1S/C9H11ClO2/c1-5-3-7(4-11)6(2)9(12)8(5)10/h3,11-12H,4H2,1-2H3 |
| InChIKey | DEGWAQJDXLUYAD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |