C8H10ClNO — CID 130047173
(6-chloro-2,5-dimethyl-3-pyridinyl)methanol (PubChem CID 130047173) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is (6-chloro-2,5-dimethyl-3-pyridinyl)methanol.
| Compound Name | (6-chloro-2,5-dimethyl-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 130047173 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (6-chloro-2,5-dimethyl-3-pyridinyl)methanol |
| SMILES | Cc1cc(CO)c(C)nc1Cl |
| InChI | InChI=1S/C8H10ClNO/c1-5-3-7(4-11)6(2)10-8(5)9/h3,11H,4H2,1-2H3 |
| InChIKey | LHCVSOBOUAVTKE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|