C10H13ClO2 — CID 84669757
(4-chloro-2-methoxy-3,5-dimethylphenyl)methanol (PubChem CID 84669757) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is (4-chloro-2-methoxy-3,5-dimethylphenyl)methanol.
| Compound Name | (4-chloro-2-methoxy-3,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 84669757 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4-chloro-2-methoxy-3,5-dimethylphenyl)methanol |
| SMILES | COc1c(CO)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C10H13ClO2/c1-6-4-8(5-12)10(13-3)7(2)9(6)11/h4,12H,5H2,1-3H3 |
| InChIKey | RIDPNGMVISJGGT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |