C10H14O4 — CID 154087943
[3,5-bis(hydroxymethyl)-4-methoxyphenyl]methanol (PubChem CID 154087943) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is [3,5-bis(hydroxymethyl)-4-methoxyphenyl]methanol.
| Compound Name | [3,5-bis(hydroxymethyl)-4-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 154087943 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [3,5-bis(hydroxymethyl)-4-methoxyphenyl]methanol |
| SMILES | COc1c(CO)cc(CO)cc1CO |
| InChI | InChI=1S/C10H14O4/c1-14-10-8(5-12)2-7(4-11)3-9(10)6-13/h2-3,11-13H,4-6H2,1H3 |
| InChIKey | RKOXVEQYAZVAHY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |