C24H26O4 — CID 73213834
[4-methoxy-3,5-bis[(4-methoxyphenyl)methyl]phenyl]methanol (PubChem CID 73213834) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is [4-methoxy-3,5-bis[(4-methoxyphenyl)methyl]phenyl]methanol.
| Compound Name | [4-methoxy-3,5-bis[(4-methoxyphenyl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 73213834 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [4-methoxy-3,5-bis[(4-methoxyphenyl)methyl]phenyl]methanol |
| SMILES | COc1ccc(Cc2cc(CO)cc(Cc3ccc(OC)cc3)c2OC)cc1 |
| InChI | InChI=1S/C24H26O4/c1-26-22-8-4-17(5-9-22)12-20-14-19(16-25)15-21(24(20)28-3)13-18-6-10-23(27-2)11-7-18/h4-11,14-15,25H,12-13,16H2,1-3H3 |
| InChIKey | YNFCSDWQVBFDDL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |