C11H16O4 — CID 139983063
2,4-bis(hydroxymethyl)-6-(1-methoxyethyl)phenol (PubChem CID 139983063) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,4-bis(hydroxymethyl)-6-(1-methoxyethyl)phenol.
| Compound Name | 2,4-bis(hydroxymethyl)-6-(1-methoxyethyl)phenol |
|---|---|
| PubChem CID | 139983063 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,4-bis(hydroxymethyl)-6-(1-methoxyethyl)phenol |
| SMILES | COC(C)c1cc(CO)cc(CO)c1O |
| InChI | InChI=1S/C11H16O4/c1-7(15-2)10-4-8(5-12)3-9(6-13)11(10)14/h3-4,7,12-14H,5-6H2,1-2H3 |
| InChIKey | JLQQXCFSUYZIDN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |