C12H16O3 — CID 22375149
2-(hydroxymethyl)-6-(methoxymethyl)-4-prop-2-enylphenol (PubChem CID 22375149) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(methoxymethyl)-4-prop-2-enylphenol.
| Compound Name | 2-(hydroxymethyl)-6-(methoxymethyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 22375149 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(hydroxymethyl)-6-(methoxymethyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(CO)c(O)c(COC)c1 |
| InChI | InChI=1S/C12H16O3/c1-3-4-9-5-10(7-13)12(14)11(6-9)8-15-2/h3,5-6,13-14H,1,4,7-8H2,2H3 |
| InChIKey | SJNZAQFRZZEJKO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|