About 4-methoxy-2,6-bis(methoxymethyl)phenol
4-methoxy-2,6-bis(methoxymethyl)phenol (PubChem CID 138470113) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-methoxy-2,6-bis(methoxymethyl)phenol.
Molecular Properties
| Compound Name | 4-methoxy-2,6-bis(methoxymethyl)phenol |
| PubChem CID | 138470113 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-methoxy-2,6-bis(methoxymethyl)phenol |
| SMILES | COCc1cc(OC)cc(COC)c1O |
| InChI | InChI=1S/C11H16O4/c1-13-6-8-4-10(15-3)5-9(7-14-2)11(8)12/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | XXDTVYWPKZKVMT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2,6-bis(methoxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,6-bis(methoxymethyl)phenol?
The IUPAC name of 4-methoxy-2,6-bis(methoxymethyl)phenol (CID 138470113) is 4-methoxy-2,6-bis(methoxymethyl)phenol.
What is the SMILES notation for 4-methoxy-2,6-bis(methoxymethyl)phenol?
The canonical SMILES for 4-methoxy-2,6-bis(methoxymethyl)phenol is COCc1cc(OC)cc(COC)c1O.
What is the InChIKey of 4-methoxy-2,6-bis(methoxymethyl)phenol?
The InChIKey is XXDTVYWPKZKVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-13-6-8-4-10(15-3)5-9(7-14-2)11(8)12/h4-5,12H,6-7H2,1-3H3.
What are the key properties of 4-methoxy-2,6-bis(methoxymethyl)phenol?
4-methoxy-2,6-bis(methoxymethyl)phenol has a molecular weight of 212.24 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,6-bis(methoxymethyl)phenol is sourced from PubChem (CID 138470113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).