C12H16O2 — CID 121008460
7-(methoxymethyl)-5-methyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 121008460) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 7-(methoxymethyl)-5-methyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 7-(methoxymethyl)-5-methyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 121008460 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 7-(methoxymethyl)-5-methyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | COCc1cc(C)c(O)c2c1CCC2 |
| InChI | InChI=1S/C12H16O2/c1-8-6-9(7-14-2)10-4-3-5-11(10)12(8)13/h6,13H,3-5,7H2,1-2H3 |
| InChIKey | MNJIRDGHGXJVTO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |