C11H16O3 — CID 176835467
2,4-bis(methoxymethyl)-5-methylphenol (PubChem CID 176835467) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,4-bis(methoxymethyl)-5-methylphenol.
| Compound Name | 2,4-bis(methoxymethyl)-5-methylphenol |
|---|---|
| PubChem CID | 176835467 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2,4-bis(methoxymethyl)-5-methylphenol |
| SMILES | COCc1cc(COC)c(O)cc1C |
| InChI | InChI=1S/C11H16O3/c1-8-4-11(12)10(7-14-3)5-9(8)6-13-2/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | YLGIYBFEVOYQQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |