About [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane
[5-(methoxymethyl)-2,4-dimethylphenyl]phosphane (PubChem CID 20671495) has the molecular formula C10H15OP
and a molecular weight of 182.20 g/mol. Its IUPAC name is [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane.
Molecular Properties
| Compound Name | [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane |
| PubChem CID | 20671495 |
| Molecular Formula | C10H15OP |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane |
| SMILES | COCc1cc(P)c(C)cc1C |
| InChI | InChI=1S/C10H15OP/c1-7-4-8(2)10(12)5-9(7)6-11-3/h4-5H,6,12H2,1-3H3 |
| InChIKey | PZROYHSFBZVREC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane?
The IUPAC name of [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane (CID 20671495) is [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane.
What is the SMILES notation for [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane?
The canonical SMILES for [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane is COCc1cc(P)c(C)cc1C.
What is the InChIKey of [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane?
The InChIKey is PZROYHSFBZVREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15OP/c1-7-4-8(2)10(12)5-9(7)6-11-3/h4-5H,6,12H2,1-3H3.
What are the key properties of [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane?
[5-(methoxymethyl)-2,4-dimethylphenyl]phosphane has a molecular weight of 182.20 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-2,4-dimethylphenyl]phosphane is sourced from PubChem (CID 20671495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).