C11H16O — CID 23572077
5-(methoxymethyl)-1,2,3-trimethylbenzene (PubChem CID 23572077) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2,3-trimethylbenzene.
| Compound Name | 5-(methoxymethyl)-1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 23572077 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 5-(methoxymethyl)-1,2,3-trimethylbenzene |
| SMILES | COCc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C11H16O/c1-8-5-11(7-12-4)6-9(2)10(8)3/h5-6H,7H2,1-4H3 |
| InChIKey | VDPCQEBMDNGUOC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |