C14H22O2 — CID 123490967
1-tert-butyl-3,5-bis(methoxymethyl)benzene (PubChem CID 123490967) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-tert-butyl-3,5-bis(methoxymethyl)benzene.
| Compound Name | 1-tert-butyl-3,5-bis(methoxymethyl)benzene |
|---|---|
| PubChem CID | 123490967 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-tert-butyl-3,5-bis(methoxymethyl)benzene |
| SMILES | COCc1cc(COC)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22O2/c1-14(2,3)13-7-11(9-15-4)6-12(8-13)10-16-5/h6-8H,9-10H2,1-5H3 |
| InChIKey | BYFRDCBXSMHDRU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |