C14H16O — CID 144628840
7-(methoxymethyl)-1,2-dimethylnaphthalene (PubChem CID 144628840) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is 7-(methoxymethyl)-1,2-dimethylnaphthalene.
| Compound Name | 7-(methoxymethyl)-1,2-dimethylnaphthalene |
|---|---|
| PubChem CID | 144628840 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 7-(methoxymethyl)-1,2-dimethylnaphthalene |
| SMILES | COCc1ccc2ccc(C)c(C)c2c1 |
| InChI | InChI=1S/C14H16O/c1-10-4-6-13-7-5-12(9-15-3)8-14(13)11(10)2/h4-8H,9H2,1-3H3 |
| InChIKey | IBXRVOTYZZKJJJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |