About azane;1-(methoxymethyl)-4-methylbenzene
azane;1-(methoxymethyl)-4-methylbenzene (PubChem CID 175555359) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is azane;1-(methoxymethyl)-4-methylbenzene.
Molecular Properties
| Compound Name | azane;1-(methoxymethyl)-4-methylbenzene |
| PubChem CID | 175555359 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | azane;1-(methoxymethyl)-4-methylbenzene |
| SMILES | COCc1ccc(C)cc1.N |
| InChI | InChI=1S/C9H12O.H3N/c1-8-3-5-9(6-4-8)7-10-2;/h3-6H,7H2,1-2H3;1H3 |
| InChIKey | GAOBLDDNLRJHGV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-(methoxymethyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(methoxymethyl)-4-methylbenzene?
The IUPAC name of azane;1-(methoxymethyl)-4-methylbenzene (CID 175555359) is azane;1-(methoxymethyl)-4-methylbenzene.
What is the SMILES notation for azane;1-(methoxymethyl)-4-methylbenzene?
The canonical SMILES for azane;1-(methoxymethyl)-4-methylbenzene is COCc1ccc(C)cc1.N.
What is the InChIKey of azane;1-(methoxymethyl)-4-methylbenzene?
The InChIKey is GAOBLDDNLRJHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.H3N/c1-8-3-5-9(6-4-8)7-10-2;/h3-6H,7H2,1-2H3;1H3.
What are the key properties of azane;1-(methoxymethyl)-4-methylbenzene?
azane;1-(methoxymethyl)-4-methylbenzene has a molecular weight of 153.22 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(methoxymethyl)-4-methylbenzene is sourced from PubChem (CID 175555359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).