About (4-methylphenyl)methyl hypochlorite
(4-methylphenyl)methyl hypochlorite (PubChem CID 174764062) has the molecular formula C8H9ClO
and a molecular weight of 156.61 g/mol. Its IUPAC name is (4-methylphenyl)methyl hypochlorite.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl hypochlorite |
| PubChem CID | 174764062 |
| Molecular Formula | C8H9ClO |
| Molecular Weight | 156.61 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | (4-methylphenyl)methyl hypochlorite |
| SMILES | Cc1ccc(COCl)cc1 |
| InChI | InChI=1S/C8H9ClO/c1-7-2-4-8(5-3-7)6-10-9/h2-5H,6H2,1H3 |
| InChIKey | GTFNDGARBQNKMZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-methylphenyl)methyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl hypochlorite?
The IUPAC name of (4-methylphenyl)methyl hypochlorite (CID 174764062) is (4-methylphenyl)methyl hypochlorite.
What is the SMILES notation for (4-methylphenyl)methyl hypochlorite?
The canonical SMILES for (4-methylphenyl)methyl hypochlorite is Cc1ccc(COCl)cc1.
What is the InChIKey of (4-methylphenyl)methyl hypochlorite?
The InChIKey is GTFNDGARBQNKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO/c1-7-2-4-8(5-3-7)6-10-9/h2-5H,6H2,1H3.
What are the key properties of (4-methylphenyl)methyl hypochlorite?
(4-methylphenyl)methyl hypochlorite has a molecular weight of 156.61 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl hypochlorite is sourced from PubChem (CID 174764062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).