C16H22O — CID 144628843
ethane;6-(methoxymethyl)-1,4-dimethylnaphthalene (PubChem CID 144628843) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;6-(methoxymethyl)-1,4-dimethylnaphthalene.
| Compound Name | ethane;6-(methoxymethyl)-1,4-dimethylnaphthalene |
|---|---|
| PubChem CID | 144628843 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | ethane;6-(methoxymethyl)-1,4-dimethylnaphthalene |
| SMILES | CC.COCc1ccc2c(C)ccc(C)c2c1 |
| InChI | InChI=1S/C14H16O.C2H6/c1-10-4-5-11(2)14-8-12(9-15-3)6-7-13(10)14;1-2/h4-8H,9H2,1-3H3;1-2H3 |
| InChIKey | SCEOPMGAYZPUNA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |