C14H16O2 — CID 68953678
1,6-bis(methoxymethyl)naphthalene (PubChem CID 68953678) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,6-bis(methoxymethyl)naphthalene.
| Compound Name | 1,6-bis(methoxymethyl)naphthalene |
|---|---|
| PubChem CID | 68953678 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1,6-bis(methoxymethyl)naphthalene |
| SMILES | COCc1ccc2c(COC)cccc2c1 |
| InChI | InChI=1S/C14H16O2/c1-15-9-11-6-7-14-12(8-11)4-3-5-13(14)10-16-2/h3-8H,9-10H2,1-2H3 |
| InChIKey | YFFPXVFMDWAAEA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |